
CAS 944906-80-3
:5-(4-Chlorophenyl)-1,3,4-oxadiazole-2-methanamine
Description:
5-(4-Chlorophenyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 4-chlorophenyl group indicates that there is a chlorinated phenyl substituent attached to the oxadiazole, which can influence the compound's electronic properties and reactivity. The methanamine functional group suggests that the compound has an amine (-NH2) functionality, which can participate in hydrogen bonding and may enhance its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its potential applications in various fields, including medicinal chemistry and materials science. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH, temperature, and the presence of other chemical species.
Formula:C9H8ClN3O
InChI:InChI=1S/C9H8ClN3O/c10-7-3-1-6(2-4-7)9-13-12-8(5-11)14-9/h1-4H,5,11H2
InChI key:InChIKey=GUHNHFQYQWJSBL-UHFFFAOYSA-N
SMILES:C(N)C=1OC(=NN1)C2=CC=C(Cl)C=C2
Synonyms:- [5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]methanamine
- 1,3,4-Oxadiazole-2-methanamine, 5-(4-chlorophenyl)-
- 5-(4-Chlorophenyl)-1,3,4-oxadiazole-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.