CAS 944906-88-1

5-(3-Bromophenyl)-1,3,4-oxadiazole-2-methanamine

Description:

5-(3-Bromophenyl)-1,3,4-oxadiazole-2-methanamine is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a bromophenyl group indicates that a bromine atom is substituted on a phenyl ring, contributing to the compound's potential reactivity and biological activity. The methanamine functional group suggests the presence of an amine, which can participate in hydrogen bonding and influence the compound's solubility and interaction with biological targets. This compound may exhibit properties such as fluorescence or antimicrobial activity, depending on its structure and substituents. Its unique combination of functional groups makes it of interest in medicinal chemistry and material science. The CAS number 944906-88-1 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₉H₈BrN₃O

InChI: InChI=1S/C9H8BrN3O/c10-7-3-1-2-6(4-7)9-13-12-8(5-11)14-9/h1-4H,5,11H2

InChI key: InChIKey=FMXBUUMIALSMFM-UHFFFAOYSA-N

SMILES: C(N)C=1OC(=NN1)C2=CC(Br)=CC=C2

Synonyms:

• 1,3,4-Oxadiazole-2-methanamine, 5-(3-bromophenyl)-
• 5-(3-Bromophenyl)-1,3,4-oxadiazole-2-methanamine

[5-(3-Bromophenyl)-1,3,4-oxadiazol-2-yl]methanamine

CAS: 944906-88-1

Versatile small molecule scaffold

Formula: C₉H₈BrN₃O

Purity: Min. 95%

Molecular weight: 254.08 g/mol

Ref: 3D-UMB90688