CAS 944907-01-1

4-(4-Fluorophenyl)-1-piperidineethanamine

Description:

4-(4-Fluorophenyl)-1-piperidineethanamine, also known by its CAS number 944907-01-1, is a chemical compound characterized by its piperidine structure, which is a six-membered ring containing one nitrogen atom. This compound features a fluorophenyl group, indicating the presence of a fluorine atom on a phenyl ring, which can influence its electronic properties and reactivity. The amine functional group contributes to its potential as a ligand in various chemical reactions and biological interactions. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making them of interest in medicinal chemistry and pharmacology. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. Overall, 4-(4-Fluorophenyl)-1-piperidineethanamine is a compound that may be explored for its therapeutic potential, particularly in the context of neurological or psychiatric disorders, given the structural motifs commonly associated with such activities.

Formula: C₁₃H₁₉FN₂

InChI: InChI=1S/C13H19FN2/c14-13-3-1-11(2-4-13)12-5-8-16(9-6-12)10-7-15/h1-4,12H,5-10,15H2

InChI key: InChIKey=RWYAZOKTPGZMSM-UHFFFAOYSA-N

SMILES: C(CN)N1CCC(CC1)C2=CC=C(F)C=C2

Synonyms:

• N-(2-Aminoethyl)-4-(4-fluorophenyl)piperidine
• 4-(4-Fluorophenyl)-1-piperidineethanamine
• 2-[4-(4-Fluorophenyl)piperidin-1-yl]ethan-1-amine
• 1-Piperidineethanamine, 4-(4-fluorophenyl)-