CAS 944907-16-8
:5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-carboxylic acid
Description:
5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-carboxylic acid is a heterocyclic organic compound characterized by its oxadiazole ring, which contains nitrogen and oxygen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 4-methoxyphenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The oxadiazole moiety is known for its diverse biological properties, including antimicrobial and anti-inflammatory activities. Additionally, the compound's structure suggests potential for hydrogen bonding and interactions with biological targets, making it a candidate for further research in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-carboxylic acid represents a class of compounds with significant potential in various chemical and biological applications.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c1-15-7-4-2-6(3-5-7)8-11-12-9(16-8)10(13)14/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=QAGOQFIFSCKSDS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1OC(=NN1)C2=CC=C(OC)C=C2
Synonyms:- 1,3,4-Oxadiazole-2-carboxylic acid, 5-(4-methoxyphenyl)-
- 5-(4-Methoxyphenyl)-1,3,4-oxadiazole-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.