
CAS 944907-26-0
:5-Pyrimidinepropanal
Description:
5-Pyrimidinepropanal is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a propanal functional group, indicating the presence of an aldehyde group (-CHO) attached to a three-carbon chain. The presence of both the pyrimidine ring and the aldehyde group contributes to its unique chemical properties, including potential reactivity in various organic reactions, such as nucleophilic addition and condensation reactions. 5-Pyrimidinepropanal may exhibit polar characteristics due to the electronegative nitrogen atoms and the aldehyde group, influencing its solubility in polar solvents. Additionally, this compound may have applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals or biologically active molecules, owing to the biological significance of pyrimidine derivatives. As with many organic compounds, safety and handling precautions should be observed, as the reactivity and toxicity can vary based on the specific context of use.
Formula:C7H8N2O
InChI:InChI=1S/C7H8N2O/c10-3-1-2-7-4-8-6-9-5-7/h3-6H,1-2H2
InChI key:InChIKey=DSCFKYLOQRKQKS-UHFFFAOYSA-N
SMILES:C(CC=O)C=1C=NC=NC1
Synonyms:- 5-Pyrimidinepropanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.