CAS 944907-30-6

6-Bromo-2-benzoxazolecarboxylic acid

Description:

6-Bromo-2-benzoxazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a carboxylic acid functional group. The presence of the bromine atom at the 6-position of the benzoxazole contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of carboxylic acids, such as acidity and the ability to form salts and esters. The benzoxazole moiety is known for its biological activity, making this compound of interest in medicinal chemistry and material science. Its CAS number, 944907-30-6, allows for easy identification and retrieval of information in chemical databases. Overall, 6-Bromo-2-benzoxazolecarboxylic acid serves as a valuable building block in organic synthesis and may have applications in pharmaceuticals and agrochemicals.

Formula: C₈H₄BrNO₃

InChI: InChI=1S/C8H4BrNO3/c9-4-1-2-5-6(3-4)13-7(10-5)8(11)12/h1-3H,(H,11,12)

InChI key: InChIKey=CIMXFTLLAUVPOK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC=2C(O1)=CC(Br)=CC2

Synonyms:

• 2-Benzoxazolecarboxylic acid, 6-bromo-
• 6-Bromo-2-benzoxazolecarboxylic acid

6-Bromobenzo[d]oxazole-2-carboxylic acid

CAS: 944907-30-6

Formula: C₈H₄BrNO₃

Molecular weight: 242.0263

Ref: IN-DA00IIAM

6-Bromobenzo[d]oxazole-2-carboxylic acid

CAS: 944907-30-6

Purity: 98%

Molecular weight: 242.0279999

Ref: 10-F722667