
CAS 944907-33-9
:6-Methyl-2-benzoxazolecarboxylic acid
Description:
6-Methyl-2-benzoxazolecarboxylic acid is an organic compound characterized by its benzoxazole ring structure, which is a fused bicyclic system containing both benzene and oxazole moieties. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group at the 6-position of the benzoxazole ring influences its solubility and reactivity. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the functional groups present. The carboxylic acid group allows for potential hydrogen bonding and interactions with other molecules, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored for potential therapeutic uses. Its unique structure and functional groups make it a subject of interest in synthetic organic chemistry and materials science.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c1-5-2-3-6-7(4-5)13-8(10-6)9(11)12/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=SAIZHTVMICFHFA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=NC=2C(O1)=CC(C)=CC2
Synonyms:- 6-Methyl-2-benzoxazolecarboxylic acid
- 2-Benzoxazolecarboxylic acid, 6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.