CAS 944907-34-0

4-Fluoro-2-benzoxazolecarboxylic acid

Description:

4-Fluoro-2-benzoxazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and a carboxylic acid functional group. This compound features a fluorine atom at the 4-position of the benzoxazole moiety, which can influence its reactivity and interaction with biological systems. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. Typically, compounds like this may exhibit properties such as moderate solubility in polar solvents, and they may be used in pharmaceutical research, agrochemicals, or as intermediates in organic synthesis. The fluorine substitution can enhance lipophilicity and metabolic stability, which are important factors in drug design. Overall, 4-Fluoro-2-benzoxazolecarboxylic acid is of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential biological activity.

Formula: C₈H₄FNO₃

InChI: InChI=1S/C8H4FNO3/c9-4-2-1-3-5-6(4)10-7(13-5)8(11)12/h1-3H,(H,11,12)

InChI key: InChIKey=FLJATSUFAWTGDS-UHFFFAOYSA-N

SMILES: FC1=C2C(OC(C(O)=O)=N2)=CC=C1

Synonyms:

• 2-Benzoxazolecarboxylic acid, 4-fluoro-
• 4-Fluoro-2-benzoxazolecarboxylic acid