CAS 944907-38-4

5-Bromo-2-benzoxazolecarboxaldehyde

Description:

5-Bromo-2-benzoxazolecarboxaldehyde is an organic compound characterized by its benzoxazole ring structure, which features a bromine substituent at the 5-position and an aldehyde functional group at the 2-position. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The aldehyde group contributes to its reactivity, allowing for further functionalization and derivatization. Additionally, the compound may exhibit biological activity, which can be explored for pharmaceutical applications. Its solubility properties can vary depending on the solvent, and it is generally handled with standard safety precautions due to the presence of halogenated compounds. Overall, 5-Bromo-2-benzoxazolecarboxaldehyde is a versatile compound with significant potential in research and development within the fields of organic and medicinal chemistry.

Formula: C₈H₄BrNO₂

InChI: InChI=1S/C8H4BrNO2/c9-5-1-2-7-6(3-5)10-8(4-11)12-7/h1-4H

InChI key: InChIKey=DLZGRSOMDWLGFW-UHFFFAOYSA-N

SMILES: C(=O)C=1OC=2C(N1)=CC(Br)=CC2

Synonyms:

• 5-Bromobenzo[d]oxazole-2-carboxaldehyde
• 5-Bromo-2-benzoxazolecarboxaldehyde
• 2-Benzoxazolecarboxaldehyde, 5-bromo-

5-Bromobenzo[d]oxazole-2-carbaldehyde

CAS: 944907-38-4

Formula: C₈H₄BrNO₂

Molecular weight: 226.0269

Ref: IN-DA01C3ME

5-Bromo-benzooxazole-2-carbaldehyde

CAS: 944907-38-4

Versatile small molecule scaffold

Formula: C₈H₄BrNO₂

Purity: Min. 95%

Molecular weight: 226.03 g/mol

Ref: 3D-UMB90738