CymitQuimica logo

CAS 944907-42-0

:

6-Methyl-2-benzoxazolecarboxaldehyde

Description:
6-Methyl-2-benzoxazolecarboxaldehyde is an organic compound characterized by its benzoxazole ring structure, which consists of a fused benzene and oxazole moiety. This compound features a methyl group at the 6-position and an aldehyde functional group at the 2-position of the benzoxazole ring. It is typically a pale yellow to light brown solid, and its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the aldehyde group makes it reactive, allowing for further chemical modifications and reactions, such as condensation and nucleophilic addition. Additionally, the compound may exhibit biological activity, which can be explored for potential therapeutic uses. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c1-6-2-3-7-8(4-6)12-9(5-11)10-7/h2-5H,1H3
InChI key:InChIKey=GUZQTRVNSUSCDI-UHFFFAOYSA-N
SMILES:C(=O)C1=NC=2C(O1)=CC(C)=CC2
Synonyms:
  • 6-Methyl-2-benzoxazolecarboxaldehyde
  • 2-Benzoxazolecarboxaldehyde, 6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.