CAS 944907-47-5

6-Fluoro-2-benzoxazolemethanamine

Description:

6-Fluoro-2-benzoxazolemethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an amine functional group. The presence of the fluorine atom at the 6-position of the benzoxazole contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amine group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as benzoxazole derivatives are often explored for their antimicrobial, anti-inflammatory, and anticancer properties. The compound's CAS number, 944907-47-5, allows for precise identification in chemical databases and literature. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 6-Fluoro-2-benzoxazolemethanamine represents a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₈H₇FN₂O

InChI: InChI=1S/C8H7FN2O/c9-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3H,4,10H2

InChI key: InChIKey=SVYNQNZWATUZCH-UHFFFAOYSA-N

SMILES: C(N)C1=NC=2C(O1)=CC(F)=CC2

Synonyms:

• 6-Fluoro-2-benzoxazolemethanamine
• (6-Fluoro-1,3-benzoxazol-2-yl)methanamine
• 2-Benzoxazolemethanamine, 6-fluoro-