CymitQuimica logo

CAS 944907-49-7

:

6-Bromo-2-benzoxazolemethanamine

Description:
6-Bromo-2-benzoxazolemethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an amine functional group. The presence of the bromine atom at the 6-position of the benzoxazole contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may also serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, 6-Bromo-2-benzoxazolemethanamine represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c9-5-1-2-6-7(3-5)12-8(4-10)11-6/h1-3H,4,10H2
InChI key:InChIKey=BHZNIRWKQALLSH-UHFFFAOYSA-N
SMILES:C(N)C1=NC=2C(O1)=CC(Br)=CC2
Synonyms:
  • 6-Bromo-2-benzoxazolemethanamine
  • 2-Benzoxazolemethanamine, 6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.