CAS 944912-19-0
:7-[tert-butyl(dimethyl)silyl]oxy-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]chromen-4-one
Description:
The chemical substance known as "7-[tert-butyl(dimethyl)silyl]oxy-3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]chromen-4-one," with the CAS number 944912-19-0, is a synthetic organic compound that belongs to the class of flavonoids, specifically a chromone derivative. This compound features a chromen-4-one core structure, which is characterized by a benzopyranone framework. The presence of tert-butyl and dimethylsilyl groups enhances its lipophilicity, potentially influencing its solubility and stability in various solvents. The silyl ether functionalities may also impart unique reactivity and protective characteristics, making it useful in organic synthesis and medicinal chemistry. Additionally, the compound's structural complexity suggests potential applications in pharmaceuticals, particularly in the development of bioactive agents. Its specific interactions and biological activities would require further investigation through experimental studies to elucidate its potential therapeutic properties. Overall, this compound exemplifies the intricate design often found in synthetic organic chemistry, combining structural diversity with functional potential.
Formula:C27H38O4Si2
InChI:InChI=1/C27H38O4Si2/c1-26(2,3)32(7,8)30-20-13-11-19(12-14-20)23-18-29-24-17-21(15-16-22(24)25(23)28)31-33(9,10)27(4,5)6/h11-18H,1-10H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc(cc1)c1coc2cc(ccc2c1=O)O[Si](C)(C)C(C)(C)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Daidzein bis-tert-butyldimethylsilyl ether
CAS:Daidzein bis-tert-butyldimethylsilyl ether is a synthetic derivative of the isoflavone daidzein, which is primarily sourced from soybeans and other legumes. It’s modified through the attachment of tert-butyldimethylsilyl ether groups, enhancing its stability and facilitating its use in various experimental conditions. This compound acts as a precursor or an intermediate in the synthesis of other complex molecules, allowing detailed structural or functional studies on isoflavones in biochemical pathways.Formula:C27H38O4Si2Purity:Min. 95%Molecular weight:482.76 g/mol

