CAS 94492-21-4

Cistanoside D

Description:

Cistanoside D is a chemical compound classified as a glycoside, specifically derived from the plant genus Cistanche, which is known for its medicinal properties. It is characterized by its complex structure, which typically includes a sugar moiety linked to a non-sugar component, contributing to its biological activity. Cistanoside D has garnered interest in pharmacological research due to its potential antioxidant, anti-inflammatory, and neuroprotective effects. The compound is often studied for its role in traditional medicine, particularly in herbal remedies aimed at enhancing vitality and overall health. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its bioavailability and efficacy in therapeutic applications. Additionally, ongoing research is focused on elucidating its mechanism of action and potential applications in treating various health conditions. As with many natural products, the extraction and purification processes are essential for obtaining Cistanoside D in a form suitable for scientific study and potential medicinal use.

Formula: C₃₁H₄₀O₁₅

InChI: InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-19(34)21(13-17)41-3)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)20(12-16)40-2/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6+/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1

InChI key: InChIKey=RLGRBYHBNWLGER-CNMJWYMJSA-N

SMILES: O([C@H]1[C@H](OC(/C=C/C2=CC(OC)=C(O)C=C2)=O)[C@@H](CO)O[C@@H](OCCC3=CC(OC)=C(O)C=C3)[C@@H]1O)[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4

Synonyms:

• β-D-Glucopyranoside, 2-(4-hydroxy-3-methoxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 4-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoate]
• Cistanoside D
• β-D-Glucopyranoside, 2-(4-hydroxy-3-methoxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 4-[3-(4-hydroxy-3-methoxyphenyl)-2-propenoate], (E)-

Cistanoside D

CAS: 94492-21-4

Cistanoside D is a phenylethanoid glycoside, which is a type of natural product with potential therapeutic applications. It is derived from the plant Cistanche deserticola, a parasitic herb traditionally used in Chinese medicine. This compound's mode of action is primarily associated with its antioxidant and anti-inflammatory effects, which suggest its beneficial role in attenuating oxidative stress and modulating the immune response.

Formula: C₃₁H₄₀O₁₅

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 652.64 g/mol

Ref: 3D-FC65939

Cistanoside D

CAS: 94492-21-4

Formula: C₃₁H₄₀O₁₅

Molecular weight: 652.65

Ref: 4Z-C-462001