CymitQuimica logo

CAS 94492-23-6

:

Osmanthuside B

Description:
Osmanthuside B is a chemical compound classified as a phenolic glycoside, primarily derived from the Osmanthus species, particularly Osmanthus fragrans. It is known for its potential biological activities, including antioxidant and anti-inflammatory properties, which are attributed to its phenolic structure. The compound typically exhibits a moderate to high solubility in polar solvents, making it suitable for various applications in natural product chemistry and pharmacology. Osmanthuside B has garnered interest in the field of herbal medicine and functional foods due to its potential health benefits. Its structure features a sugar moiety linked to a phenolic aglycone, which contributes to its reactivity and interaction with biological systems. Research into Osmanthuside B is ongoing, focusing on its mechanisms of action and potential therapeutic applications. As with many natural compounds, the extraction and purification processes can influence its yield and bioactivity, making it a subject of interest for further studies in phytochemistry and medicinal applications.
Formula:C29H36O13
InChI:InChI=1S/C29H36O13/c1-15-22(34)23(35)24(36)29(39-15)42-27-25(37)28(38-13-12-17-4-9-19(32)10-5-17)40-20(14-30)26(27)41-21(33)11-6-16-2-7-18(31)8-3-16/h2-11,15,20,22-32,34-37H,12-14H2,1H3/b11-6+/t15-,20+,22-,23+,24+,25+,26+,27+,28+,29-/m0/s1
InChI key:InChIKey=PRTREKIVGSNQRM-DQHNYDBYSA-N
SMILES:O([C@H]1[C@H](OC(/C=C/C2=CC=C(O)C=C2)=O)[C@@H](CO)O[C@@H](OCCC3=CC=C(O)C=C3)[C@@H]1O)[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:
  • β-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 4-[(2E)-3-(4-hydroxyphenyl)-2-propenoate]
  • Osmanthuside B
  • Ligupurpuroside D
  • β-D-Glucopyranoside, 2-(4-hydroxyphenyl)ethyl 3-O-(6-deoxy-α-L-mannopyranosyl)-, 4-[3-(4-hydroxyphenyl)-2-propenoate], (E)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Osmanthuside B

    CAS:
    Osmanthuside B, isolated from Pseuderanthemum carruthersii (Seem.) Guill.
    Formula:C29H36O13
    Color and Shape:Solid
    Molecular weight:592.59

    Ref: TM-T80009

    5mg
    To inquire
    50mg
    To inquire