CAS 944936-26-9
:triisopropyl-(4-methoxypyrrolo[2,3-b]pyridin-1-yl)silane
Description:
Triisopropyl-(4-methoxypyrrolo[2,3-b]pyridin-1-yl)silane is an organosilicon compound characterized by the presence of a silane group attached to a pyrrolo-pyridine moiety. This compound features a triisopropyl group, which enhances its steric bulk and solubility in organic solvents. The methoxy group at the 4-position of the pyrrolo-pyridine structure contributes to its electronic properties, potentially influencing reactivity and interaction with other chemical species. The presence of the silane functionality suggests potential applications in materials science, particularly in the development of silane-based coatings or as a coupling agent in organic synthesis. Additionally, the compound may exhibit interesting biological activities due to its heterocyclic structure, which is common in various pharmaceuticals. Its molecular structure and properties make it a subject of interest in both synthetic and medicinal chemistry, although specific reactivity and stability would depend on the surrounding conditions and the presence of other reactants.
Formula:C17H28N2OSi
InChI:InChI=1/C17H28N2OSi/c1-12(2)21(13(3)4,14(5)6)19-11-9-15-16(20-7)8-10-18-17(15)19/h8-14H,1-7H3
SMILES:CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(ccnc12)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.