CAS 944936-49-6
:N-Methoxy-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide
Description:
N-Methoxy-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide is a chemical compound characterized by its unique pyrrolopyridine structure, which combines elements of both pyrrole and pyridine. This compound features a methoxy group and a methyl group attached to the nitrogen atom, contributing to its overall polarity and potential solubility in various solvents. The carboxamide functional group enhances its ability to engage in hydrogen bonding, which can influence its reactivity and interactions with biological targets. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the pyrrolopyridine framework often suggests potential applications in drug development, particularly in areas such as neuropharmacology or oncology. Additionally, the compound's molecular structure may allow for various synthetic modifications, enabling the exploration of structure-activity relationships. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-13(15-2)10(14)8-5-7-3-4-11-9(7)12-6-8/h3-6H,1-2H3,(H,11,12)
InChI key:InChIKey=HGYNJNSMXQICAI-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C=1C=C2C(=NC1)NC=C2
Synonyms:- N-Methoxy-N-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxamide
- 1H-Pyrrolo[2,3-b]pyridine-5-carboxamide, N-methoxy-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.