CAS 945-32-4

1H-pyrrole-2,3,5-tricarboxylic acid

Description:

1H-Pyrrole-2,3,5-tricarboxylic acid, also known as pyrrole-2,3,5-tricarboxylic acid, is an organic compound characterized by its pyrrole ring structure with three carboxylic acid functional groups attached at the 2, 3, and 5 positions. This compound is typically a white to off-white solid that is soluble in water due to the presence of the carboxylic acid groups, which can ionize and interact with water molecules. It exhibits acidic properties, making it a potential candidate for various chemical reactions, including esterification and amidation. The presence of multiple carboxylic acid groups allows for the formation of hydrogen bonds, which can influence its reactivity and interactions with other molecules. Additionally, this compound may have applications in the synthesis of polymers, pharmaceuticals, and agrochemicals, owing to its unique structural features. Its chemical behavior can be further explored in the context of coordination chemistry, where it may act as a ligand for metal ions.

Formula: C₇H₅NO₆

InChI: InChI=1/C7H5NO6/c9-5(10)2-1-3(6(11)12)8-4(2)7(13)14/h1,8H,(H,9,10)(H,11,12)(H,13,14)

SMILES: c1c(c(C(=O)O)[nH]c1C(=O)O)C(=O)O

1H-Pyrrole-2,3,5-tricarboxylicacid

CAS: 945-32-4

Formula: C₇H₅NO₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.1177

Ref: IN-DA006A0I

1H-Pyrrole-2,3,5-tricarboxylic acid

CAS: 945-32-4

1H-Pyrrole-2,3,5-tricarboxylic acid

Purity: 97%

Molecular weight: 199.12g/mol

Ref: 54-OR1001246

Melatonin Related Compound (Pyrrole-2,3,5-Tricarboxylic Acid)

CAS: 945-32-4

Formula: C₇H₅NO₆

Color and Shape: Brown Solid

Molecular weight: 199.12

Ref: 4Z-M-767

Pyrrole-2,3,5-tricarboxylic Acid

Controlled Product

CAS: 945-32-4

Applications The most characteristic degrdadation product of melanins. An important biomarker for Melatonin (M215000) metabolism.
References Shen, X., et al.: J. Med. Chem., 39, 2018 (1996), Xin, W., et a: Chem. Res. Toxicol., 13, 749 (2000), An, L., et al.: Food Chem. Toxicol., 44, 436 (2006),

Formula: C₇H₅NO₆

Color and Shape: Neat

Molecular weight: 199.12

Ref: TR-P997885

Pyrrole-2,3,5-tricarboxylic acid

CAS: 945-32-4

Formula: C₇H₅NO₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.118

Ref: 10-F306858