CAS 945-32-4
:1H-pyrrole-2,3,5-tricarboxylic acid
Description:
1H-Pyrrole-2,3,5-tricarboxylic acid, also known as pyrrole-2,3,5-tricarboxylic acid, is an organic compound characterized by its pyrrole ring structure with three carboxylic acid functional groups attached at the 2, 3, and 5 positions. This compound is typically a white to off-white solid that is soluble in water due to the presence of the carboxylic acid groups, which can ionize and interact with water molecules. It exhibits acidic properties, making it a potential candidate for various chemical reactions, including esterification and amidation. The presence of multiple carboxylic acid groups allows for the formation of hydrogen bonds, which can influence its reactivity and interactions with other molecules. Additionally, this compound may have applications in the synthesis of polymers, pharmaceuticals, and agrochemicals, owing to its unique structural features. Its chemical behavior can be further explored in the context of coordination chemistry, where it may act as a ligand for metal ions.
Formula:C7H5NO6
InChI:InChI=1/C7H5NO6/c9-5(10)2-1-3(6(11)12)8-4(2)7(13)14/h1,8H,(H,9,10)(H,11,12)(H,13,14)
SMILES:c1c(c(C(=O)O)[nH]c1C(=O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Pyrrole-2,3,5-tricarboxylic acid
CAS:1H-Pyrrole-2,3,5-tricarboxylic acidFormula:C7H5NO6Purity:97%Molecular weight:199.121H-Pyrrole-2,3,5-tricarboxylicacid
CAS:Formula:C7H5NO6Purity:97%Color and Shape:SolidMolecular weight:199.1177Melatonin Related Compound (Pyrrole-2,3,5-Tricarboxylic Acid)
CAS:Formula:C7H5NO6Color and Shape:Brown SolidMolecular weight:199.12Pyrrole-2,3,5-tricarboxylic Acid
CAS:Controlled ProductApplications The most characteristic degrdadation product of melanins. An important biomarker for Melatonin (M215000) metabolism.
References Shen, X., et al.: J. Med. Chem., 39, 2018 (1996), Xin, W., et a: Chem. Res. Toxicol., 13, 749 (2000), An, L., et al.: Food Chem. Toxicol., 44, 436 (2006),Formula:C7H5NO6Color and Shape:NeatMolecular weight:199.12Pyrrole-2,3,5-tricarboxylic acid
CAS:Formula:C7H5NO6Purity:97%Color and Shape:SolidMolecular weight:199.118




