
CAS 945016-64-8
:3-(2-Chloro-4-pyrimidinyl)pyrazolo[1,5-a]pyridine
Description:
3-(2-Chloro-4-pyrimidinyl)pyrazolo[1,5-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes both pyrazole and pyridine rings. The presence of a chloro substituent on the pyrimidine moiety contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The unique arrangement of nitrogen atoms within its rings can influence its electronic properties and interactions with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Overall, 3-(2-Chloro-4-pyrimidinyl)pyrazolo[1,5-a]pyridine represents a class of compounds with significant interest in drug discovery and development.
Formula:C11H7ClN4
InChI:InChI=1S/C11H7ClN4/c12-11-13-5-4-9(15-11)8-7-14-16-6-2-1-3-10(8)16/h1-7H
InChI key:InChIKey=XORCJJMEUVGUAW-UHFFFAOYSA-N
SMILES:ClC=1N=C(C2=C3N(N=C2)C=CC=C3)C=CN1
Synonyms:- 3-(2-Chloro-4-pyrimidinyl)pyrazolo[1,5-a]pyridine
- Pyrazolo[1,5-a]pyridine, 3-(2-chloro-4-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.