CAS 945029-05-0
:methyl (E)-3-(1H-pyrrolo[3,2-e]pyridin-5-yl)prop-2-enoate
Description:
Methyl (E)-3-(1H-pyrrolo[3,2-e]pyridin-5-yl)prop-2-enoate is an organic compound characterized by its unique structure, which includes a pyrrolopyridine moiety and an ester functional group. This compound features a methyl ester group attached to a prop-2-enoate backbone, indicating it has both alkene and ester characteristics. The presence of the pyrrolopyridine ring contributes to its potential biological activity, as such heterocycles are often found in pharmacologically active compounds. The (E) configuration denotes the specific geometric arrangement around the double bond, which can influence the compound's reactivity and interactions. This substance may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, it may have applications in medicinal chemistry or as a building block in organic synthesis, given the significance of pyridine derivatives in drug development. Overall, its structural features suggest a compound of interest in various chemical and biological contexts.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-15-10(14)3-2-8-6-9-4-5-12-11(9)13-7-8/h2-7H,1H3,(H,12,13)/b3-2+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester
CAS:Formula:C11H10N2O2Molecular weight:202.2093
