CAS 94520-78-2
:2-[methyl(2-methylbenzyl)amino]ethanol
Description:
2-[Methyl(2-methylbenzyl)amino]ethanol, with the CAS number 94520-78-2, is an organic compound characterized by its amine and alcohol functional groups. This substance features a two-carbon ethanol backbone, which is substituted with a methyl group and a 2-methylbenzyl group attached to the nitrogen atom. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and formation of salts. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing solubility in polar solvents. Additionally, the aromatic ring from the 2-methylbenzyl moiety can influence the compound's hydrophobicity and overall reactivity. This compound may be of interest in pharmaceutical applications or as an intermediate in organic synthesis due to its unique structural features. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-10-5-3-4-6-11(10)9-12(2)7-8-13/h3-6,13H,7-9H2,1-2H3
SMILES:Cc1ccccc1CN(C)CCO
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.