CAS 945217-56-1

3-methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole

Description:

3-Methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyrazole moiety. This compound typically exhibits a molecular formula that reflects its complex arrangement of carbon, hydrogen, and nitrogen atoms. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the methyl group contributes to its chemical reactivity and solubility properties. Additionally, the tetrahydropyrrole ring system can influence its interaction with biological targets, potentially affecting its pharmacological profile. The compound may also exhibit specific physical properties such as melting point, boiling point, and solubility in various solvents, which are essential for its application in research and industry. Overall, 3-methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole represents a significant class of compounds with diverse applications in chemical and pharmaceutical research.

Formula: C₆H₉N₃

InChI: InChI=1S/C6H9N3/c1-4-5-2-7-3-6(5)9-8-4/h7H,2-3H2,1H3,(H,8,9)

SMILES: Cc1c2CNCc2n[nH]1

3-Methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole

CAS: 945217-56-1

Formula: C₆H₉N₃

Molecular weight: 123.1558

Ref: IN-DA00IIB7

3-Methyl-1,4,5,6-tetrahydropyrrolo[3,4-c]pyrazole

CAS: 945217-56-1

Formula: C₆H₉N₃

Purity: 95.0%

Molecular weight: 123.159

Ref: 10-F223744