CAS 945242-95-5
:2-bromo-N-(1,2-diphenylethylideneamino)aniline
Description:
2-bromo-N-(1,2-diphenylethylideneamino)aniline is an organic compound characterized by its complex structure, which includes a bromine atom, an aniline moiety, and a diphenylethylidene group. This compound features a bromo substituent on the aromatic ring, which can influence its reactivity and solubility. The presence of the diphenylethylidene group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in chemical reactions. The compound's structure may exhibit specific stereochemical properties due to the presence of the ethylidene linkage, which can affect its biological activity. Additionally, the aniline part of the molecule can participate in various chemical reactions, such as electrophilic substitutions or coupling reactions. Overall, 2-bromo-N-(1,2-diphenylethylideneamino)aniline is a compound of interest in research due to its unique structural features and potential applications in various fields of chemistry.
Formula:C20H17BrN2
InChI:InChI=1/C20H17BrN2/c21-18-13-7-8-14-19(18)22-23-20(17-11-5-2-6-12-17)15-16-9-3-1-4-10-16/h1-14,22H,15H2/b23-20+
Synonyms:- (2E)-1-(2-Bromophenyl)-2-(1,2-diphenylethylidene)hydrazine
- Ethanone, 1,2-diphenyl-, 2-(2-bromophenyl)hydrazone, (1E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2-Bromophenyl)-N'-(1,2-diphenylethylidene)hydrazine
CAS:Formula:C20H17BrN2Molecular weight:365.2664
