CAS 945244-31-5

1-(3-Chloro-4-hydroxyphenyl)cyclopropanecarboxylic acid

Description:

1-(3-Chloro-4-hydroxyphenyl)cyclopropanecarboxylic acid is a chemical compound characterized by its cyclopropane structure, which is a three-membered carbon ring. This compound features a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of a chloro group and a hydroxy group on the phenyl ring enhances its potential for hydrogen bonding and influences its solubility and reactivity in various chemical environments. The chloro substituent can also affect the compound's electronic properties, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the hydroxy group can participate in intermolecular interactions, which may impact the compound's physical properties, such as melting and boiling points. This compound may have applications in pharmaceuticals or agrochemicals, given its structural features that can interact with biological systems. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₀H₉ClO₃

InChI: InChI=1S/C10H9ClO3/c11-7-5-6(1-2-8(7)12)10(3-4-10)9(13)14/h1-2,5,12H,3-4H2,(H,13,14)

InChI key: InChIKey=YAGVSCARZZXXKU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(CC1)C2=CC(Cl)=C(O)C=C2

Synonyms:

• 1-(3-Chloro-4-hydroxyphenyl)cyclopropane-1-carboxylic acid
• Cyclopropanecarboxylic acid, 1-(3-chloro-4-hydroxyphenyl)-
• 1-(3-Chloro-4-hydroxyphenyl)cyclopropanecarboxylic acid