
CAS 945244-36-0
:1-(2-Methyl-1H-benzimidazol-6-yl)cyclopropanecarboxylic acid
Description:
1-(2-Methyl-1H-benzimidazol-6-yl)cyclopropanecarboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a benzimidazole moiety. The presence of the benzimidazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The cyclopropanecarboxylic acid functional group introduces acidity and can influence the compound's reactivity and solubility. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in areas such as pharmaceuticals, where modifications to the benzimidazole or cyclopropane components could lead to derivatives with enhanced efficacy or reduced side effects. Additionally, the compound's stability, solubility, and overall behavior in biological systems would be critical factors in determining its practical applications. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C12H12N2O2
InChI:InChI=1S/C12H12N2O2/c1-7-13-9-3-2-8(6-10(9)14-7)12(4-5-12)11(15)16/h2-3,6H,4-5H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=KNYGHQQOCHYYSP-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(CC1)C=2C=C3C(=CC2)N=C(C)N3
Synonyms:- 1-(2-Methyl-1H-benzimidazol-5-yl)cyclopropanecarboxylic acid
- Cyclopropanecarboxylic acid, 1-(2-methyl-1H-benzimidazol-6-yl)-
- 1-(2-Methyl-1H-1,3-benzodiazol-6-yl)cyclopropane-1-carboxylic acid
- 1-(2-Methyl-1H-benzimidazol-6-yl)cyclopropanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.