CymitQuimica logo

CAS 945257-53-4

:

4-Methoxypyridine-3-sulfonyl chloride

Description:
4-Methoxypyridine-3-sulfonyl chloride is an organic compound characterized by its pyridine ring, which is substituted at the 3-position with a sulfonyl chloride group and at the 4-position with a methoxy group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its reactivity due to the presence of the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions, making it useful in various synthetic applications, particularly in the preparation of sulfonamides and other derivatives. The methoxy group contributes to its solubility in organic solvents and can influence its electronic properties. Additionally, 4-Methoxypyridine-3-sulfonyl chloride may exhibit biological activity, making it of interest in pharmaceutical research. As with many sulfonyl chlorides, it should be handled with care due to its potential to release hydrochloric acid upon reaction and its reactivity towards water and amines. Proper safety precautions should be taken when working with this compound.
Formula:C6H6ClNO3S
InChI:InChI=1S/C6H6ClNO3S/c1-11-5-2-3-8-4-6(5)12(7,9)10/h2-4H,1H3
SMILES:COc1ccncc1S(=O)(=O)Cl
Synonyms:
  • 4-Methoxy-3-pyridinesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.