CAS 945298-39-5

2-[(3-Methoxypropyl)amino]-3-pyridinecarbonitrile

Description:

2-[(3-Methoxypropyl)amino]-3-pyridinecarbonitrile, with the CAS number 945298-39-5, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a cyano group (-C≡N) at the 3-position of the pyridine, contributing to its potential reactivity and applications in various chemical processes. The presence of a methoxypropylamino group at the 2-position enhances its solubility and may influence its biological activity. Generally, compounds of this nature can exhibit diverse pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, and the presence of both the cyano and amino functionalities may facilitate various chemical reactions, including nucleophilic substitutions. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 2-[(3-Methoxypropyl)amino]-3-pyridinecarbonitrile represents a versatile structure in organic synthesis and drug development.

Formula: C₁₀H₁₃N₃O

InChI: InChI=1S/C10H13N3O/c1-14-7-3-6-13-10-9(8-11)4-2-5-12-10/h2,4-5H,3,6-7H2,1H3,(H,12,13)

InChI key: InChIKey=VNKLSMVFMKEQEQ-UHFFFAOYSA-N

SMILES: N(CCCOC)C1=C(C#N)C=CC=N1

Synonyms:

• 2-[(3-Methoxypropyl)amino]-3-pyridinecarbonitrile
• 3-Pyridinecarbonitrile, 2-[(3-methoxypropyl)amino]-