CymitQuimica logo

CAS 945313-25-7

:

4-(2-fluorobenzoyl)cyclohexane-1-carboxylic acid

Description:
4-(2-Fluorobenzoyl)cyclohexane-1-carboxylic acid is an organic compound characterized by its cyclohexane ring structure substituted with a carboxylic acid group and a 2-fluorobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the fluorobenzoyl group and the cyclohexane framework. The fluorine atom in the 2-fluorobenzoyl group can influence the compound's reactivity and polarity, potentially enhancing its solubility in polar solvents. The carboxylic acid functional group contributes to its acidity and can participate in hydrogen bonding, affecting its interactions in various chemical environments. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in drug development or as a building block in organic synthesis. Overall, the compound's unique combination of functional groups and structural characteristics makes it a subject of interest in both synthetic and medicinal chemistry.
Formula:C14H15FO3
InChI:InChI=1/C14H15FO3/c15-12-4-2-1-3-11(12)13(16)9-5-7-10(8-6-9)14(17)18/h1-4,9-10H,5-8H2,(H,17,18)/t9-,10-
SMILES:c1ccc(c(c1)C(=O)[C@H]1CC[C@@H](CC1)C(=O)O)F
Synonyms:
  • TRANS-4-(2-FLUOROBENZOYL)CYCLOHEXANE-1-CARBOXYLIC ACID
  • 4-(2-fluorobenzoyl)cyclohexane-1-carboxylic acid
  • Cyclohexanecarboxylic acid, 4-(2-fluorobenzoyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.