CymitQuimica logo

CAS 945367-17-9

:

5-Nitro-2-(2-pyridinylamino)benzonitrile

Description:
5-Nitro-2-(2-pyridinylamino)benzonitrile is an organic compound characterized by its complex structure, which includes a nitro group, a pyridinylamino group, and a benzonitrile moiety. The presence of the nitro group typically imparts significant electron-withdrawing properties, influencing the compound's reactivity and solubility. The pyridinylamino group introduces basicity and potential for hydrogen bonding, which can affect the compound's interactions in biological systems or with other chemical entities. This compound may exhibit properties such as moderate to high lipophilicity, depending on the substituents and their positions on the aromatic rings. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the aromatic components. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of targeted therapies. Safety and handling precautions should be observed, as with many nitro-containing compounds, due to potential toxicity and environmental concerns.
Formula:C12H8N4O2
InChI:InChI=1S/C12H8N4O2/c13-8-9-7-10(16(17)18)4-5-11(9)15-12-3-1-2-6-14-12/h1-7H,(H,14,15)
InChI key:InChIKey=CCEDMUKBTAKLPF-UHFFFAOYSA-N
SMILES:N(C1=C(C#N)C=C(N(=O)=O)C=C1)C2=CC=CC=N2
Synonyms:
  • Benzonitrile, 5-nitro-2-(2-pyridinylamino)-
  • 5-Nitro-2-(2-pyridinylamino)benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.