CAS 945397-19-3
:5-(Methylsulfonyl)-1,3-benzenediamine
Description:
5-(Methylsulfonyl)-1,3-benzenediamine, identified by its CAS number 945397-19-3, is an organic compound characterized by the presence of a benzene ring substituted with two amino groups and a methylsulfonyl group. This compound typically exhibits properties associated with aromatic amines, including potential solubility in polar solvents due to the presence of the amino groups. The methylsulfonyl group enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical and chemical research. The compound's structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, which are common for amines. Additionally, the presence of the sulfonyl group can impart unique electronic properties, potentially affecting its interaction with other molecules. Safety data should be consulted, as aromatic amines can pose health risks, including potential carcinogenicity. Overall, 5-(Methylsulfonyl)-1,3-benzenediamine is a compound of interest in both synthetic chemistry and medicinal applications.
Formula:C7H10N2O2S
InChI:InChI=1S/C7H10N2O2S/c1-12(10,11)7-3-5(8)2-6(9)4-7/h2-4H,8-9H2,1H3
InChI key:InChIKey=KVTFOWBVFGINPR-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=CC(N)=CC(N)=C1
Synonyms:- 5-(Methylsulfonyl)-1,3-benzenediamine
- 1,3-Benzenediamine, 5-(methylsulfonyl)-
- 5-Methylsulfonylbenzene-1,3-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
