CAS 945397-20-6

3-(4-Methyl-1-piperazinyl)-5-(methylsulfonyl)benzenamine

Description:

3-(4-Methyl-1-piperazinyl)-5-(methylsulfonyl)benzenamine, identified by its CAS number 945397-20-6, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with both a piperazine moiety and a methylsulfonyl group. The presence of the piperazine ring contributes to its potential biological activity, as piperazines are often found in pharmacologically active compounds. The methylsulfonyl group enhances the compound's solubility and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's properties, such as solubility, melting point, and reactivity, would be influenced by the specific arrangement of its substituents and the overall molecular geometry. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₉N₃O₂S

InChI: InChI=1S/C12H19N3O2S/c1-14-3-5-15(6-4-14)11-7-10(13)8-12(9-11)18(2,16)17/h7-9H,3-6,13H2,1-2H3

InChI key: InChIKey=HEPQBBJRWUFAFF-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C=1C=C(C=C(N)C1)N2CCN(C)CC2

Synonyms:

• 3-(4-Methylpiperazin-1-yl)-5-(methylsulfonyl)aniline
• 3-(4-Methyl-1-piperazinyl)-5-(methylsulfonyl)benzenamine
• Benzenamine, 3-(4-methyl-1-piperazinyl)-5-(methylsulfonyl)-