
CAS 945400-92-0
:2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzothiazole
Description:
2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzothiazole is an organic compound characterized by its complex structure, which includes a benzothiazole moiety, a bromine atom, and a silyl ether functional group. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The dimethylethylsilyl group enhances the compound's stability and solubility, while also providing potential for further functionalization. This compound is likely to exhibit moderate to high lipophilicity due to its hydrophobic components, which can influence its biological activity and interaction with cellular membranes. Additionally, the benzothiazole framework is known for its diverse biological properties, including antimicrobial and anticancer activities. As with many organobromine compounds, safety precautions should be observed due to potential toxicity and environmental concerns. Overall, 2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzothiazole represents a versatile building block in chemical research and development.
Formula:C13H18BrNOSSi
InChI:InChI=1S/C13H18BrNOSSi/c1-13(2,3)18(4,5)16-9-6-7-10-11(8-9)17-12(14)15-10/h6-8H,1-5H3
InChI key:InChIKey=QXFKFLYCFAVKDO-UHFFFAOYSA-N
SMILES:BrC1=NC=2C(=CC(O[Si](C(C)(C)C)(C)C)=CC2)S1
Synonyms:- Benzothiazole, 2-bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-
- 2-Bromo-6-[[(1,1-dimethylethyl)dimethylsilyl]oxy]benzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.