
CAS 945419-79-4
:Hexanoic acid, 3-amino-, ethyl ester, hydrochloride (1:1)
Description:
Hexanoic acid, 3-amino-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a hexanoic acid backbone with an amino group and an ethyl ester functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the amino group suggests potential basic properties, while the hexanoic acid moiety contributes to its fatty acid characteristics. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its hydrochloride form indicates that it is a salt, which can influence its stability and reactivity. As with many amino acid derivatives, it may participate in various chemical reactions, including esterification and amidation, and could serve as an intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C8H17NO2·ClH
InChI:InChI=1S/C8H17NO2.ClH/c1-3-5-7(9)6-8(10)11-4-2;/h7H,3-6,9H2,1-2H3;1H
InChI key:InChIKey=RJNLWXVORNLJGW-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)(CCC)N.Cl
Synonyms:- Hexanoic acid, 3-amino-, ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.