CymitQuimica logo

CAS 945426-70-0

:

[3-(3-methoxybutanoyl)-2,4,4-trimethyl-cyclohex-2-en-1-yl] acetate

Description:
The chemical substance known as [3-(3-methoxybutanoyl)-2,4,4-trimethyl-cyclohex-2-en-1-yl] acetate, with the CAS number 945426-70-0, is a complex organic compound characterized by its unique structural features. It contains a cyclohexene ring, which contributes to its cyclic nature and potential reactivity. The presence of the acetate functional group suggests that it may exhibit ester-like properties, influencing its solubility and volatility. Additionally, the methoxybutanoyl substituent introduces a branched alkyl chain, which can affect the compound's physical properties, such as boiling point and polarity. This compound may also display interesting biological activities due to its structural complexity, making it a candidate for various applications in fields like pharmaceuticals or agrochemicals. Its synthesis and stability would depend on the specific conditions under which it is prepared, including temperature and the presence of catalysts. Overall, the compound's characteristics are defined by its molecular structure, functional groups, and potential interactions with other substances.
Formula:C16H26O4
InChI:InChI=1/C16H26O4/c1-10(19-6)9-13(18)15-11(2)14(20-12(3)17)7-8-16(15,4)5/h10,14H,7-9H2,1-6H3
SMILES:CC(CC(=O)C1=C(C)C(CCC1(C)C)OC(=O)C)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.