CAS 945457-70-5
:5-Methyl-1H-pyrazole-1-propanenitrile
Description:
5-Methyl-1H-pyrazole-1-propanenitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a methyl group at the 5-position of the pyrazole ring and a propanenitrile group, which contributes to its reactivity and potential applications in various chemical processes. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility in organic solvents. This compound is of interest in medicinal chemistry and agrochemical research due to its potential biological activity and utility in synthesizing other complex molecules. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 5-Methyl-1H-pyrazole-1-propanenitrile represents a versatile building block in organic synthesis.
Formula:C7H9N3
InChI:InChI=1S/C7H9N3/c1-7-3-5-9-10(7)6-2-4-8/h3,5H,2,6H2,1H3
InChI key:InChIKey=QIKFKQJVFSUKBL-UHFFFAOYSA-N
SMILES:C(CC#N)N1C(C)=CC=N1
Synonyms:- 1H-Pyrazole-1-propanenitrile, 5-methyl-
- 5-Methyl-1H-pyrazole-1-propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.