CAS 94549-87-8
:dimethyl (2E,2'E)-3,3'-(disulfanediyldibenzene-4,1-diyl)bisprop-2-enoate
Description:
Dimethyl (2E,2'E)-3,3'-(disulfanediyldibenzene-4,1-diyl)bisprop-2-enoate is a complex organic compound characterized by its unique structure, which includes two prop-2-enoate groups and a disulfide linkage connecting two benzene rings. This compound features a symmetrical arrangement due to the presence of the disulfide bond, which contributes to its stability and reactivity. The presence of the prop-2-enoate moieties indicates that it can participate in various chemical reactions, such as polymerization or cross-linking, making it potentially useful in materials science and organic synthesis. The compound is likely to exhibit moderate solubility in organic solvents, while its reactivity may be influenced by the electron-withdrawing nature of the disulfide and the aromatic rings. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, would be determined by its molecular interactions and the presence of functional groups. Overall, this compound represents a fascinating example of a multifunctional organic molecule with potential applications in various fields.
Formula:C20H18O4S2
InChI:InChI=1/C20H18O4S2/c1-23-19(21)13-7-15-3-9-17(10-4-15)25-26-18-11-5-16(6-12-18)8-14-20(22)24-2/h3-14H,1-2H3/b13-7+,14-8+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl-4,4’-dithiobiscinnamate
CAS:Controlled ProductFormula:C20H18O4S2Color and Shape:NeatMolecular weight:386.48
