CAS 94556-80-6: 2-amino-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile
Description:2-Amino-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features two methoxy-substituted phenyl groups, enhancing its aromatic character and potentially influencing its electronic properties. The presence of an amino group contributes to its basicity and reactivity, while the carbonitrile functional group introduces a strong electron-withdrawing characteristic, which can affect the compound's overall polarity and solubility. The molecular structure suggests potential applications in pharmaceuticals or materials science, particularly due to the presence of multiple functional groups that can participate in various chemical reactions. Additionally, the compound's unique combination of functionalities may impart interesting biological activities, making it a candidate for further research in medicinal chemistry. Its CAS number, 94556-80-6, allows for easy identification and reference in chemical databases and literature. Overall, this compound exemplifies the complexity and versatility of organic molecules in synthetic chemistry.
Formula:C19H16N2O3
InChI:InChI=1/C19H16N2O3/c1-22-14-7-3-12(4-8-14)17-16(11-20)19(21)24-18(17)13-5-9-15(23-2)10-6-13/h3-10H,21H2,1-2H3
- Synonyms:
- 2-Amino-4,5-bis(4-methoxyphenyl)-3-furonitrile
- 2-Amino-4,5-bis-(4-methoxy-phenyl)-furan-3-carbonitrile
- 3-Furancarbonitrile, 2-Amino-4,5-Bis(4-Methoxyphenyl)-
- 2-Amino-4,5-bis(4-methoxyphenyl)furan-3-carbonitrile

2-amino-4,5-bis(4-methoxyphenyl)-3-furonitrile
Ref: IN-DA00JHJ9
1g | 124.00 € | ||
5g | 507.00 € | ||
100mg | 59.00 € | ||
250mg | 77.00 € |

2-Amino-4,5-Bis(4-Methoxyphenyl)Furan-3-Carbonitrile
Ref: 54-OR1025018
1g | 119.00 € | ||
5g | 371.00 € | ||
25g | 1,583.00 € | ||
250mg | 51.00 € |

Ref: 10-F375349
1g | To inquire | ||
5g | To inquire | ||
250mg | To inquire |

2-Amino-4,5-bis(4-methoxyphenyl)-3-furonitrile
Ref: 3D-FA133536
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |