CAS 945610-03-7
:2-(4-tert-butoxycarbonylphenyl)-2-fluoro-acetic acid
Description:
2-(4-tert-butoxycarbonylphenyl)-2-fluoro-acetic acid is a chemical compound characterized by its unique structure, which includes a fluorinated acetic acid moiety and a tert-butoxycarbonyl (Boc) protecting group attached to a phenyl ring. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the bulky Boc group. The presence of the fluorine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The Boc group serves as a protective group for amines, facilitating various synthetic pathways in organic synthesis. Additionally, the compound may exhibit specific optical properties due to the presence of the fluorine atom and the aromatic system, which can be relevant in applications such as drug design or material science. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C13H15FO4
InChI:InChI=1/C13H15FO4/c1-13(2,3)18-12(17)9-6-4-8(5-7-9)10(14)11(15)16/h4-7,10H,1-3H3,(H,15,16)
SMILES:CC(C)(C)OC(=O)c1ccc(cc1)C(C(=O)O)F
Synonyms:- [4-(tert-Butoxycarbonyl)phenyl](fluoro)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
