CAS 945632-75-7
:3,4-Dihydro-6-octyl-1(2H)-naphthalenone
Description:
3,4-Dihydro-6-octyl-1(2H)-naphthalenone, identified by its CAS number 945632-75-7, is an organic compound characterized by its naphthalene structure, which is a bicyclic aromatic hydrocarbon. This compound features a ketone functional group, contributing to its reactivity and potential applications in various chemical processes. The presence of an octyl group enhances its hydrophobic properties, making it more soluble in organic solvents than in water. Its molecular structure suggests it may exhibit interesting physical properties, such as a relatively high boiling point and moderate volatility. Additionally, the compound may possess biological activity, which could be explored for potential applications in pharmaceuticals or agrochemicals. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation. Overall, 3,4-Dihydro-6-octyl-1(2H)-naphthalenone represents a unique compound within the realm of organic chemistry, with potential utility in various industrial and research applications.
Formula:C18H26O
InChI:InChI=1S/C18H26O/c1-2-3-4-5-6-7-9-15-12-13-17-16(14-15)10-8-11-18(17)19/h12-14H,2-11H2,1H3
InChI key:InChIKey=GDKDOVHLKSSPTH-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(CCCCCCCC)=CC2)CCC1
Synonyms:- 3,4-Dihydro-6-octyl-1(2H)-naphthalenone
- 1(2H)-Naphthalenone, 3,4-dihydro-6-octyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
