
CAS 945632-77-9
:2-Bromo-3,4-dihydro-6-octyl-1(2H)-naphthalenone
Description:
2-Bromo-3,4-dihydro-6-octyl-1(2H)-naphthalenone is an organic compound characterized by its complex structure, which includes a naphthalene ring system with a bromine substituent and an octyl side chain. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The octyl group provides hydrophobic characteristics, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and materials science. Its molecular structure suggests potential applications in the development of dyes, pharmaceuticals, or as intermediates in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C18H25BrO
InChI:InChI=1S/C18H25BrO/c1-2-3-4-5-6-7-8-14-9-11-16-15(13-14)10-12-17(19)18(16)20/h9,11,13,17H,2-8,10,12H2,1H3
InChI key:InChIKey=ZBADJFWIUJXHTL-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(CCCCCCCC)=CC2)CCC1Br
Synonyms:- 2-Bromo-6-octyl-3,4-dihydro-2H-naphthalen-1-one
- 1(2H)-Naphthalenone, 2-bromo-3,4-dihydro-6-octyl-
- 2-Bromo-3,4-dihydro-6-octyl-1(2H)-naphthalenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
