CAS 945717-58-8

3-Chloro-5-cyclopropylbenzoic acid

Description:

3-Chloro-5-cyclopropylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a cyclopropyl group attached to a benzoic acid framework. The chlorine substituent is located at the meta position (3-position) relative to the carboxylic acid group, while the cyclopropyl group is positioned at the para position (5-position) on the benzene ring. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic cyclopropyl group. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the unique structural features of 3-chloro-5-cyclopropylbenzoic acid may influence its biological activity, making it of interest in pharmaceutical research. Its molecular structure can also affect its reactivity and interactions with other chemical species, which is important for applications in organic synthesis and material science.

Formula: C₁₀H₉ClO₂

InChI: InChI=1S/C10H9ClO2/c11-9-4-7(6-1-2-6)3-8(5-9)10(12)13/h3-6H,1-2H2,(H,12,13)

InChI key: InChIKey=MHVOAKYRJQGWLA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(Cl)C1)C2CC2

Synonyms:

• Benzoic acid, 3-chloro-5-cyclopropyl-
• 3-Chloro-5-cyclopropylbenzoic acid

Benzoic acid, 3-chloro-5-cyclopropyl-

CAS: 945717-58-8

Formula: C₁₀H₉ClO₂

Purity: >95%

Molecular weight: 196.6303

Ref: IN-DA01PFU2

3-Chloro-5-cyclopropylbenzoic acid

CAS: 945717-58-8

Versatile small molecule scaffold

Formula: C₁₀H₉ClO₂

Purity: Min. 95%

Molecular weight: 196.63 g/mol

Ref: 3D-VMB71758