CAS 94574-42-2
:6-phenylimidazo[2,1-b][1,3]thiazol-5-amine
Description:
6-Phenylimidazo[2,1-b][1,3]thiazol-5-amine is a heterocyclic compound characterized by its unique fused ring structure, which includes an imidazole and thiazole moiety. This compound features a phenyl group attached to the imidazole ring, contributing to its aromatic properties. The presence of an amine functional group at the 5-position of the thiazole ring enhances its reactivity and potential for forming hydrogen bonds. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. They may interact with various biological targets, potentially influencing cellular processes. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, its molecular structure suggests potential applications in fields such as pharmaceuticals, agrochemicals, or materials science. As with many heterocycles, the specific characteristics, including melting point, boiling point, and spectral properties, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C11H9N3S
InChI:InChI=1/C11H9N3S/c12-10-9(8-4-2-1-3-5-8)13-11-14(10)6-7-15-11/h1-7H,12H2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
6-Phenylimidazo[2,1-b][1,3]thiazol-5-amine
CAS:<p>6-Phenylimidazo[2,1-b][1,3]thiazol-5-amine is a reactive chemical substance with a polylactic functional group. It is an organic solvent that is used in pharmaceutical preparations. 6-Phenylimidazo[2,1-b][1,3]thiazol-5-amine can be hydrolyzed by hydrolysis to form active substances such as fatty acids and aromatic hydrocarbons. The aromatic hydrocarbons are derived from the fatty acid esters that are formed during the process of glycolysis. 6-Phenylimidazo[2,1-b][1,3]thiazol-5-amine is used as a plant science for its ability to inhibit the growth of plants.</p>Formula:C11H9N3SPurity:Min. 95%Molecular weight:215.28 g/mol

