CymitQuimica logo

CAS 945761-95-5

:

3-Bromo-7-iodo-1H-indazole

Description:
3-Bromo-7-iodo-1H-indazole is a heterocyclic compound characterized by the presence of both bromine and iodine substituents on the indazole ring system. Indazoles are five-membered aromatic rings containing two nitrogen atoms, which contribute to the compound's unique chemical properties. The presence of halogens, specifically bromine and iodine, can significantly influence the compound's reactivity, stability, and potential applications in medicinal chemistry and material science. Typically, such halogenated indazoles exhibit interesting biological activities, making them valuable in drug discovery and development. The compound's molecular structure allows for various synthetic modifications, which can enhance its pharmacological properties. Additionally, the presence of multiple halogens may affect its solubility and interaction with biological targets. As with many halogenated compounds, care must be taken regarding their environmental impact and toxicity. Overall, 3-Bromo-7-iodo-1H-indazole represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H4BrIN2
InChI:InChI=1S/C7H4BrIN2/c8-7-4-2-1-3-5(9)6(4)10-11-7/h1-3H,(H,10,11)
InChI key:InChIKey=CSVJSYJEYYTJPV-UHFFFAOYSA-N
SMILES:IC1=C2C(C(Br)=NN2)=CC=C1
Synonyms:
  • 3-Bromo-7-iodo-1H-indazole
  • 1H-Indazole, 3-bromo-7-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.