CAS 945895-41-0
:1-(2-Chloro-4-pyrimidinyl)-3-pyrrolidinamine
Description:
1-(2-Chloro-4-pyrimidinyl)-3-pyrrolidinamine, with the CAS number 945895-41-0, is a chemical compound characterized by its unique structure that includes a pyrimidine ring and a pyrrolidine moiety. The presence of the chloro substituent on the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the pyrrolidine ring. It may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is studied. Overall, 1-(2-Chloro-4-pyrimidinyl)-3-pyrrolidinamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C8H11ClN4
InChI:InChI=1S/C8H11ClN4/c9-8-11-3-1-7(12-8)13-4-2-6(10)5-13/h1,3,6H,2,4-5,10H2
InChI key:InChIKey=HOMJACHULQDJAF-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=CN1)N2CCC(N)C2
Synonyms:- 3-Pyrrolidinamine, 1-(2-chloro-4-pyrimidinyl)-
- 1-(2-Chloro-4-pyrimidinyl)-3-pyrrolidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.