CAS 946-02-1

4-chlorobutyl benzoate

Description:

4-Chlorobutyl benzoate is an organic compound characterized by its ester functional group, formed from the reaction of 4-chlorobutanol and benzoic acid. It typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the chlorine atom in the butyl chain influences its chemical reactivity and solubility properties, making it more polar than its non-chlorinated counterparts. This compound is generally soluble in organic solvents such as ethanol and ether but has limited solubility in water. 4-Chlorobutyl benzoate is often used in organic synthesis and as an intermediate in the production of various chemical products. Its applications may extend to the fields of pharmaceuticals, agrochemicals, and polymer chemistry. As with many chlorinated compounds, it is essential to handle 4-chlorobutyl benzoate with care due to potential health and environmental concerns associated with chlorinated organic compounds. Proper safety measures should be taken to minimize exposure and ensure safe handling in laboratory and industrial settings.

Formula: C₁₁H₁₃ClO₂

InChI: InChI=1/C11H13ClO2/c12-8-4-5-9-14-11(13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2

SMILES: c1ccc(cc1)C(=O)OCCCCCl

Synonyms:

• 1-Butanol, 4-Chloro-, Benzoate

4-Chlorobutyl Benzoate

CAS: 946-02-1

Formula: C₁₁H₁₃ClO₂

Purity: >98.0%(GC)

Color and Shape: White - Yellow Liquid

Molecular weight: 212.67

Ref: 3B-B1399

1-Butanol, 4-chloro-, benzoate

CAS: 946-02-1

Formula: C₁₁H₁₃ClO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 212.6727

Ref: IN-DA00IIDT

4-Chlorobutyl Benzoate

CAS: 946-02-1

4-Chlorobutyl Benzoate

Purity: 98%

Molecular weight: 212.67g/mol

Ref: 54-OR1026846

4-Chlorobutyl benzoate

CAS: 946-02-1

Purity: 98%(GC);RG

Molecular weight: 212.6699982

Ref: 10-F721396