CAS 946-32-7
:Benzoic acid, 2-hydroxy-5-nitro-, hydrazide
Description:
Benzoic acid, 2-hydroxy-5-nitro-, hydrazide, also known by its CAS number 946-32-7, is an organic compound characterized by the presence of a benzoic acid moiety with a hydroxyl group and a nitro group at specific positions on the aromatic ring. This compound typically appears as a crystalline solid and is soluble in organic solvents, with limited solubility in water. Its structure includes a hydrazide functional group, which contributes to its reactivity and potential applications in various chemical reactions, including as a reagent in organic synthesis. The presence of the nitro group can impart unique electronic properties, making it useful in the development of pharmaceuticals and agrochemicals. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing the compound's physical properties and interactions. Overall, benzoic acid, 2-hydroxy-5-nitro-, hydrazide is of interest in both research and industrial applications due to its diverse chemical behavior and potential utility in various fields.
Formula:C7H7N3O4
InChI:InChI=1S/C7H7N3O4/c8-9-7(12)5-3-4(10(13)14)1-2-6(5)11/h1-3,11H,8H2,(H,9,12)
InChI key:InChIKey=IFROEJRAWJNALM-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC(N(=O)=O)=CC=C1O
Synonyms:- Benzoic acid, 2-hydroxy-5-nitro-, hydrazide
- 2-Hydroxy-5-nitrobenzoic acid hydrazide
- Salicylic acid, 5-nitro-, hydrazide
- (2-Hydroxy-5-nitrobenzoyl)hydrazine
- 5-Nitrosalicyl hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Hydroxy-5-nitrobenzohydrazide
CAS:2-Hydroxy-5-nitrobenzohydrazide is an antibacterial agent that binds to the hydroxylase domain of bacterial 7-ethoxycoumarin hydroxylase, a key enzyme in the synthesis of tetranuclear cofactors. It forms a coordination geometry with the metal ions that are required for this enzyme, thereby blocking its activity. 2-Hydroxy-5-nitrobenzohydrazide has been shown to be effective against bacteria such as Staphylococcus aureus, Escherichia coli, and Pseudomonas aeruginosa. This compound also has a specific affinity for mononuclear bacteria such as Proteus mirabilis and Klebsiella pneumoniae. 2-Hydroxy-5-nitrobenzohydrazide is not active against Gram positive bacteria due to its lack of binding affinity for the epoxide hydrolase domain of bacterial 7-ethoxycouFormula:C7H7N3O4Purity:Min. 95%Molecular weight:197.15 g/mol
