
CAS 94600-20-1
:Acetic acid, 2-[(1-bromo-2-naphthalenyl)oxy]-, sodium salt (1:1)
Description:
Acetic acid, 2-[(1-bromo-2-naphthalenyl)oxy]-, sodium salt (1:1), with CAS number 94600-20-1, is a chemical compound that features a sodium salt form of acetic acid, which is modified by the presence of a bromo-substituted naphthalene moiety. This compound typically exhibits characteristics associated with both acetic acid and aromatic compounds. It is likely to be soluble in polar solvents due to the presence of the sodium salt, while the naphthalene group may impart hydrophobic properties. The bromo substituent can influence the compound's reactivity, potentially making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the naphthalene ring may contribute to its stability and may also affect its biological activity, making it of interest in pharmaceutical and agrochemical applications. Overall, this compound represents a unique combination of functionalities that can be exploited in synthetic chemistry and material science.
Formula:C12H9BrO3·Na
InChI:InChI=1S/C12H9BrO3.Na/c13-12-9-4-2-1-3-8(9)5-6-10(12)16-7-11(14)15;/h1-6H,7H2,(H,14,15);
InChI key:InChIKey=VLFHUYCEVQOTGU-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC1OCC(O)=O)C=CC=C2.[Na]
Synonyms:- Acetic acid, 2-[(1-bromo-2-naphthalenyl)oxy]-, sodium salt (1:1)
- Acetic acid, [(1-bromo-2-naphthyl)oxy]-, sodium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.