CymitQuimica logo

CAS 946049-56-5

:

2-[4-(trifluoromethyl)phenyl]-2,3-dihydro-1H-quinolin-4-one

Description:
2-[4-(Trifluoromethyl)phenyl]-2,3-dihydro-1H-quinolin-4-one is a chemical compound characterized by its unique structure, which includes a quinoline core fused with a phenyl group that carries a trifluoromethyl substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and interaction with biological targets. It may also exhibit fluorescence, making it useful in various applications, including medicinal chemistry and materials science. The compound's molecular structure suggests potential for diverse pharmacological activities, and it may be investigated for its role in drug development or as a synthetic intermediate. As with many quinoline derivatives, it may possess antimicrobial, anti-inflammatory, or anticancer properties, although specific biological activities would require empirical investigation. Safety and handling considerations should be observed due to the presence of fluorinated groups, which can impact toxicity and environmental behavior.
Formula:C16H12F3NO
InChI:InChI=1/C16H12F3NO/c17-16(18,19)11-7-5-10(6-8-11)14-9-15(21)12-3-1-2-4-13(12)20-14/h1-8,14,20H,9H2
SMILES:c1ccc2c(c1)C(=O)CC(c1ccc(cc1)C(F)(F)F)N2
Synonyms:
  • 2-[4-(Trifluoromethyl)phenyl]-2,3-dihydroquinolin-4(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.