CAS 946112-73-8

1-Benzyl-6-bromoisatin

Description:

1-Benzyl-6-bromoisatin is an organic compound characterized by its unique structure, which includes a benzyl group and a bromine atom attached to the isatin core. Isatin itself is a diketone derived from indole, and the presence of the bromine atom at the 6-position enhances its reactivity and potential for various chemical transformations. The benzyl group contributes to the compound's lipophilicity, which can influence its solubility in organic solvents. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Its synthesis typically involves bromination and subsequent substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the presence of both electron-withdrawing and electron-donating groups in its structure can affect its electronic properties, making it a subject of study in the field of organic electronics and materials science. Overall, 1-benzyl-6-bromoisatin is a versatile compound with significant implications in various chemical research areas.

Formula: C₁₅H₁₀BrNO₂

InChI: InChI=1S/C15H10BrNO2/c16-11-6-7-12-13(8-11)17(15(19)14(12)18)9-10-4-2-1-3-5-10/h1-8H,9H2

InChI key: InChIKey=YGLYTXQMVGIKBW-UHFFFAOYSA-N

SMILES: C(N1C=2C(C(=O)C1=O)=CC=C(Br)C2)C3=CC=CC=C3

Synonyms:

• 1-Benzyl-6-bromo-2,3-dihydro-1H-indole-2,3-dione
• 6-Bromo-1-(phenylmethyl)-1H-indole-2,3-dione
• 1-Benzyl-6-bromoindoline-2,3-dione
• 1H-Indole-2,3-dione, 6-bromo-1-(phenylmethyl)-
• 1-Benzyl-6-bromoisatin