CAS 946122-05-0

(2-amino-4-bromo-phenyl)methanol

Description:

(2-amino-4-bromo-phenyl)methanol, with the CAS number 946122-05-0, is an organic compound characterized by the presence of an amino group, a bromine atom, and a hydroxymethyl group attached to a phenyl ring. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents due to the hydroxyl group. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The bromine substituent can enhance the compound's electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the phenyl ring contributes to the compound's stability and can affect its electronic properties. Overall, (2-amino-4-bromo-phenyl)methanol may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its functional groups and structural characteristics.

Formula: C₇H₈BrNO

InChI: InChI=1/C7H8BrNO/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4,9H2

SMILES: c1cc(cc(c1CO)N)Br

Synonyms:

• (2-Amino-4-bromophenyl)methanol
• Benzenemethanol, 2-Amino-4-Bromo-

(2-Amino-4-bromophenyl)methanol

CAS: 946122-05-0

Formula: C₇H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 202.0485

Ref: IN-DA0069FL

2-Amino-4-bromobenzyl alcohol

CAS: 946122-05-0

2-Amino-4-bromobenzyl alcohol

Purity: 99%

Molecular weight: 202.05g/mol

Ref: 54-OR471584

(2-Amino-4-bromophenyl)methanol

CAS: 946122-05-0

Formula: C₇H₈BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 202.051

Ref: 10-F377085